View source for 3F-PVP

{{Short description|Substituted cathinone stimulant drug}}
{{Distinguish|3F-PCP}}
{{drugbox
| drug_name          = 3-Fluoro-α-PVP
| image              = 3-F-aPVP.svg
| legal_CA           = Schedule I
| legal_DE           = NpSG
| legal_UK           = Class B
| C                  = 15
| H                  = 20
| F                  = 1
| N                  = 1
| O                  = 1
| IUPAC_name         = 1-(3-fluorophenyl)-2-(pyrrolidin-1-yl)pentan-1-one
| CAS_number         = 2725852-55-9
| ChemSpiderID       = 107437100
| PubChem            = 137700196
| smiles             = CCCC(C(=O)c1cccc(F)c1)N1CCCC1
| StdInChI           = 1S/C15H20FNO/c1-2-6-14(17-9-3-4-10-17)15(18)12-7-5-8-13(16)11-12/h5,7-8,11,14H,2-4,6,9-10H2,1H3
| StdInChIKey        = GPAALPLKXRJJDE-UHFFFAOYSA-N
}}
'''3-Fluoro-α-Pyrrolidinovalerophenone''' ('''3F-PVP''') is a recreational [[designer drug]] from the [[substituted cathinone]] family with [[stimulant]] effects, which first appeared on the illicit market in around 2018.<ref>[https://drugsdata.org/view.php?id=6288 Drugsdata.org 3F-a-PVP (3-Fluoro-a-PVP). Sold as: 3F-A-PVP. 4 June 2018]</ref><ref>[https://knowdrugs.app/drugs/bErymwScqVFvesJKvgR3/3F-a-PVP Knowdrugs.app Warnings: 3F-a-PVP. 22 June 2018]</ref> It is illegal in Finland.<ref>[https://finlex.fi/fi/laki/ajantasa/2014/20141130#a12.11.2020-764 Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista]</ref>
== See also ==
* [[3-Me-PVP]]
* [[3-Fluoroamphetamine]]
* [[3-Fluoromethamphetamine]]
* [[3-Fluoroethamphetamine]]
* [[3-Fluoromethcathinone]]
* [[3-Fluorophenmetrazine]]
* [[3F-NEB]]
* [[3F-NEH]]
* [[3F-PHP]]
* [[3F-PiHP]]
* [[4F-PVP]]
* [[4Cl-PVP]]
* [[4F-PHP]]
== References ==
{{reflist}}
{{Stimulants}}
[[Category:Pyrrolidinophenones]]
[[Category:Designer drugs]]
[[Category:Serotonin-norepinephrine-dopamine releasing agents]]
{{nervous-system-drug-stub}}