View source for AGN-2979

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477235509
| IUPAC_name = 3-(3-Dimethylaminopropyl)-3-(3-methoxyphenyl)-4,4-dimethyl-piperidine-2,6-dione
| image = AGN-2979.svg
| width = 175
<!--Clinical data-->
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number = 53873-21-5
| CAS_supplemental = 103353-87-3 ([[hydrochloride|HCl]])
| CAS_number_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P4HXVYBZ5F
| ATC_prefix = None
| ATC_suffix =
| PubChem = 40914
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 37360
<!--Chemical data-->
| C=19 | H=28 | N=2 | O=3
| smiles = O=C1NC(=O)CC(C1(c2cccc(OC)c2)CCCN(C)C)(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H28N2O3/c1-18(2)13-16(22)20-17(23)19(18,10-7-11-21(3)4)14-8-6-9-15(12-14)24-5/h6,8-9,12H,7,10-11,13H2,1-5H3,(H,20,22,23)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UJFNSGBGJMRZKS-UHFFFAOYSA-N
}}
'''AGN-2979''' is a [[glutarimide]] [[tryptophan hydroxylase]] activation inhibitor.<ref name = "Hasegawa">{{cite journal | vauthors = Hasegawa S, Kanemaru K, Gittos M, Diksic M | title = The tryptophan hydroxylase activation inhibitor, AGN-2979, decreases regional 5-HT synthesis in the rat brain measured with alpha-[14C]methyl-L-tryptophan: an autoradiographic study | journal = Brain Research Bulletin | volume = 67 | issue = 3 | pages = 248–55 | date = October 2005 | pmid = 16144662 | doi = 10.1016/j.brainresbull.2005.07.009 | s2cid = 41905586 }}</ref><ref name = "Gittos">{{cite journal | vauthors = Gittos MW, Papp M | title = Antidepressant-like action of AGN 2979, a tryptophan hydroxylase activation inhibitor, in a chronic mild stress model of depression in rats | journal = European Neuropsychopharmacology | volume = 11 | issue = 5 | pages = 351–7 | date = October 2001 | pmid = 11597821 | doi = 10.1016/S0924-977X(01)00103-1 | s2cid = 46635727 }}</ref> It shows [[antidepressant]] properties in [[rodent]] models of [[Depression (mood)|depression]].<ref name = "Gittos" />
== References ==
{{Reflist}}
{{Monoamine metabolism modulators}}
[[Category:Glutarimides]]
[[Category:3-Methoxyphenyl compounds]]
[[Category:Tryptophan hydroxylase inhibitors]]
[[Category:Dimethylamino compounds]]
{{nervous-system-drug-stub}}