View source for AMG-36

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 413289634
| IUPAC_name = (6aR,10aR)-3-(1-hexylcyclopentyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
| image = AMG-36 Structure.svg
| width = 240
<!--Clinical data-->
| tradename =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number = 579444-43-2
| PubChem = 10982174
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9157375
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 108868
<!--Chemical data-->
| C=27 | H=40 | O=2
| smiles = CC2(C)Oc1cc(C4(CCCCCC)CCCC4)cc(O)c1C(C3)C2CC=C3C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H40O2/c1-5-6-7-8-13-27(14-9-10-15-27)20-17-23(28)25-21-16-19(2)11-12-22(21)26(3,4)29-24(25)18-20/h11,17-18,21-22,28H,5-10,12-16H2,1-4H3/t21-,22-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FONCHEGPDSYFCG-FGZHOGPDSA-N
}}
'''AMG-36''' (part of the [[List of AM cannabinoids|AM cannabinoid series]])  is an [[analgesic]] drug which is a [[cannabinoid]] [[agonist]]. It is a derivative of Δ<sup>8</sup>-[[THC]] substituted with a [[cyclopentane]] group on the 3-position side chain. AMG-36 is a potent agonist at both [[Cannabinoid receptor 1|CB<sub>1</sub>]] and [[Cannabinoid receptor 2|CB<sub>2</sub>]] with moderate selectivity for CB<sub>1</sub>, with a [[Dissociation constant|K<sub>i</sub>]] of 0.45&nbsp;nM at CB<sub>1</sub> vs 1.92&nbsp;nM at CB<sub>2</sub>.<ref>{{cite journal | vauthors = Papahatjis DP, Nikas SP, Kourouli T, Chari R, Xu W, Pertwee RG, Makriyannis A | title = Pharmacophoric requirements for the cannabinoid side chain. Probing the cannabinoid receptor subsite at C1' | journal = Journal of Medicinal Chemistry | volume = 46 | issue = 15 | pages = 3221–9 | date = July 2003 | pmid = 12852753 | doi = 10.1021/jm020558c }}</ref><ref>{{cite journal | vauthors = Papahatjis DP, Nahmias VR, Nikas SP, Andreou T, Alapafuja SO, Tsotinis A, Guo J, Fan P, Makriyannis A | display-authors = 6 | title = C1'-cycloalkyl side chain pharmacophore in tetrahydrocannabinols | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 17 | pages = 4048–60 | date = August 2007 | pmid = 17672444 | doi = 10.1021/jm070121a }}</ref>
== See also ==
* [[AMG-3]]
* [[AMG-41]]
== References ==
{{reflist}}
{{cannabinoids}}
[[Category:Cannabinoids]]
[[Category:Benzochromenes]]
[[Category:Hydroxyarenes]]
[[Category:Cyclopentanes]]
{{cannabinoid-stub}}