View source for BD1052

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = N-[2-(3,4-dichlorophenyl)ethyl]-N-2-propen-1-yl-1-pyrrolidineethanamine
| image = BD1052.png
<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref =
| CAS_number = 138356-16-8
| ATC_prefix =
| ATC_suffix =
| DrugBank_Ref =
| DrugBank =
|  PubChem = 9797436
|  ChemSpiderID = 7973202
|  smiles = Clc1ccc(cc1Cl)CCN(CCN2CCCC2)C\C=C
|  StdInChI = 1S/C17H24Cl2N2/c1-2-8-20(12-13-21-9-3-4-10-21)11-7-15-5-6-16(18)17(19)14-15/h2,5-6,14H,1,3-4,7-13H2
|  StdInChIKey = IKFDBDJFYBCATB-UHFFFAOYSA-N
<!--Chemical data-->
| C=17 | H=24 | N=2 | Cl=2
}}
'''BD1052''' or '''N-[2-(3,4-dichlorophenyl)ethyl]-N-2-propen-1-yl-1-pyrrolidineethanamine''' is a selective [[sigma receptor]] [[agonist]], with a reported [[binding affinity]] of ''K''<sub>i</sub> = 2 ± 0.5 nM for the [[sigma-1 receptor]] and 30 times selectivity over the [[sigma-2 receptor]].<ref name="Matsumoto_2001">{{cite journal |vauthors=Matsumoto RR, McCracken KA, Pouw B, Miller J, Bowen WD, Williams W, De Costa BR | title = N-alkyl substituted analogs of the sigma receptor ligand BD1008 and traditional sigma receptor ligands affect cocaine-induced convulsions and lethality in mice | journal = Eur. J. Pharmacol. | volume = 411 | issue = 3 | pages = 261–73 | year = 2001 | doi = 10.1016/s0014-2999(00)00917-1| pmid = 11164383 }}</ref>
Consistent with other reported [[sigma receptor]] [[agonist]]s, pretreating Swiss Webster mice with BD1052 significantly increases the behavioral toxicity of cocaine.<ref name="Matsumoto_2001" />
==See also==
* [[BD1008]]
* [[BD1031]]
* [[LR132]]
==References==
{{reflist}}
{{Sigma receptor modulators}}
[[Category:Sigma agonists]]
[[Category:Chloroarenes]]
[[Category:1-Pyrrolidinyl compounds]]
[[Category:Allyl compounds]]