View source for CP-135807

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 450440304
| IUPAC_name = 3-([(2R)-1-methylpyrrolidin-2-yl]methyl)-N-(3-nitropyridin-2-yl)-1H-indol-5-amine
| image = CP-135807 Structure.svg
| width = 220
<!--Clinical data-->
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 151272-90-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TE348FQ6DA
| ATC_prefix =
| ATC_suffix =
| ChEMBL = 80913
|  PubChem = 5487088
|  ChemSpiderID = 4589207
<!--Chemical data-->
| C=19 | H=21 | N=5 | O=2
| smiles = CN1CCC[C@@H]1Cc2c[nH]c3c2cc(cc3)Nc4c(cccn4)[N+](=O)[O-]
|  StdInChI = 1S/C19H21N5O2/c1-23-9-3-4-15(23)10-13-12-21-17-7-6-14(11-16(13)17)22-19-18(24(25)26)5-2-8-20-19/h2,5-8,11-12,15,21H,3-4,9-10H2,1H3,(H,20,22)/t15-/m1/s1
|  StdInChIKey = YPFIYPNOWVPAPR-OAHLLOKOSA-N
| melting_point =
| melting_high =
}}
'''CP-135807''' is a drug which acts as a potent and selective [[agonist]] for the [[5-HT1D|5-HT<sub>1D</sub>]] [[serotonin]] [[receptor (biochemistry)|receptor]], and is used to study the function of this receptor subtype.<ref name="pmid8972551">{{cite journal |vauthors=Mansbach RS, Rovetti CC, Macor JE |title=CP-135,807, a selective 5-HT1D agonist: effects in drug discrimination and punishment procedures in the pigeon |journal=Psychopharmacology |volume=128 |issue=3 |pages=313–9 |date=December 1996 |pmid=8972551 |doi= 10.1007/s002130050139|s2cid=19376926 }}</ref><ref name="pmid10462130">{{cite journal |vauthors=Hertel P, Nomikos GG, Svensson TH |title=The antipsychotic drug risperidone interacts with auto- and hetero-receptors regulating serotonin output in the rat frontal cortex |journal=Neuropharmacology |volume=38 |issue=8 |pages=1175–84 |date=August 1999 |pmid=10462130 |doi= 10.1016/S0028-3908(99)00045-3|s2cid=33060351 }}</ref>
==See also==
* [[4-HO-MPMI]]
* [[5-MeO-MPMI]]
* [[Eletriptan]]
* [[LY-334370]]
==References==
{{Reflist}}
{{Serotonergics}}
{{Tryptamines}}
[[Category:2-Aminopyridines]]
[[Category:Alpha-Alkyltryptamines]]
[[Category:Nitroarenes]]
[[Category:Pyrrolidines]]
[[Category:Serotonin receptor agonists]]
{{nervous-system-drug-stub}}