View source for DPI-287

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 430786118
| IUPAC_name = 4-[(R)-[(2S,5R)-2,5-dimethyl-4-benzylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N,N-diethylbenzamide
| image = DPI-287.svg
<!--Clinical data-->
| tradename =
| legal_status =
<!--Identifiers-->
| CAS_number =
| PubChem = 21025820
<!--Chemical data-->
| C=31 | H=39 | N=3 | O=2
| smiles = CCN(CC)C(=O)c2ccc(cc2)C(c(ccc4)cc4O)N(CC1C)C(C)CN1Cc3ccccc3
}}
'''DPI-287''' is an [[opioid]] [[drug]] that is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]], which produces less [[convulsion]]s than most drugs from this family.<ref>{{cite journal | vauthors = Jutkiewicz EM | title = The antidepressant-like effects of delta-opioid receptor agonists | journal = Molecular Interventions | volume = 6 | issue = 3 | pages = 162–9 | date = June 2006 | pmid = 16809477 | doi = 10.1124/mi.6.3.7 }}</ref> It has [[antidepressant]]-like effects.<ref>{{cite journal | vauthors = Jutkiewicz EM, Chang KJ, Rice KC, Woods JH | date = 2005 | title = Characterization of a novel nonpeptide delta-opioid agonist analog DPI287 with antidepressant-like activity. | journal = Experimental Biology Meeting Abstracts | number = Abstract # 874.4 }}</ref>
==See also==
* [[AZD2327]]
* [[BW373U86]]
* [[DPI-3290]]
== References ==
{{Reflist|2}}
{{Opioidergics}}
[[Category:Synthetic opioids]]
[[Category:Delta-opioid receptor agonists]]
[[Category:Benzamides]]
[[Category:Piperazines]]
[[Category:3-Hydroxyphenyl compounds]]
[[Category:Diethylamino compounds]]
{{analgesic-stub}}