View source for GRL-0617

{{Short description|Chemical compound}}
{{infobox drug
| drug_name = GRL-0617
| image = GRL-0617_structure.png
| legal_UK =
| legal_DE =
| C = 20 | H = 20 | N = 2 | O = 1
| IUPAC_name = 5-amino-2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]benzamide
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 1093070-16-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = GRL-0617
| ChEBI = 167176
| ChEMBL = 549695
| ChemSpiderID      = 24617535
| DrugBank = DB08656
| IUPHAR_ligand = 11078
| PubChem = 24941262
| smiles            = CC1=C(C=C(C=C1)N)C(=O)N[C@H](C)C2=CC=CC3=CC=CC=C32
| StdInChI          = 1S/C20H20N2O/c1-13-10-11-16(21)12-19(13)20(23)22-14(2)17-9-5-7-15-6-3-4-8-18(15)17/h3-12,14H,21H2,1-2H3,(H,22,23)/t14-/m1/s1
| StdInChIKey       = UVERBUNNCOKGNZ-CQSZACIVSA-N
}}
'''GRL-0617''' is a drug which is one of the first compounds discovered that acts as a selective small-molecule inhibitor of the [[protease]] [[enzyme]] [[papain-like protease]] (PLpro) found in some human pathogenic viruses, including the [[coronavirus]] [[SARS-CoV-2]]. It has been shown to inhibit viral replication ''in silico'' <ref>{{cite journal | vauthors = Shanker AK, Bhanu D, Alluri A, Gupta S | title = Whole-genome sequence analysis and homology modelling of the main protease and non-structural protein 3 of SARS-CoV-2 reveal an aza-peptide and a lead inhibitor with possible antiviral properties | journal = New Journal of Chemistry | volume = 44 | issue = 22 | pages = 9202–9212| date = May 2020 | doi = 10.1039/D0NJ00974A | s2cid = 218938798 }}</ref> and ''in vitro''.<ref>{{cite journal | vauthors = Shin D, Mukherjee R, Grewe D, Bojkova D, Baek K, Bhattacharya A, Schulz L, Widera M, Mehdipour AR, Tascher G, Geurink PP, Wilhelm A, van der Heden van Noort GJ, Ovaa H, Müller S, Knobeloch KP, Rajalingam K, Schulman BA, Cinatl J, Hummer G, Ciesek S, Dikic I | display-authors = 6 | title = Papain-like protease regulates SARS-CoV-2 viral spread and innate immunity | journal = Nature | volume = 587 | issue = 7835 | pages = 657–662 | date = November 2020 | pmid = 32726803 | doi = 10.1038/s41586-020-2601-5 | pmc = 7116779 | bibcode = 2020Natur.587..657S }}</ref><ref>{{cite journal | vauthors = Hajbabaie R, Harper MT, Rahman T | title = Establishing an Analogue Based In Silico Pipeline in the Pursuit of Novel Inhibitory Scaffolds against the SARS Coronavirus 2 Papain-Like Protease | journal = Molecules | volume = 26 | issue = 4 | date = February 2021 | page = 1134 | pmid = 33672721 | doi = 10.3390/molecules26041134 | pmc = 7924369 | url = https://www.repository.cam.ac.uk/bitstream/handle/1810/318010/molecules-26-01134-v2.pdf?sequence=3&isAllowed=y | doi-access = free }}</ref><ref>{{cite journal | vauthors = Lim CT, Tan KW, Wu M, Ulferts R, Armstrong LA, Ozono E, Drury LS, Milligan JC, Zeisner TU, Zeng J, Weissmann F, Canal B, Bineva-Todd G, Howell M, O'Reilly N, Beale R, Kulathu Y, Labib K, Diffley JF | display-authors = 6 | title = Identifying SARS-CoV-2 antiviral compounds by screening for small molecule inhibitors of Nsp3 papain-like protease | journal = The Biochemical Journal | volume = 478 | issue = 13 | pages = 2517–2531 | date = July 2021 | pmid = 34198325 | doi = 10.1042/BCJ20210244 | pmc = 8286840 }}</ref><ref>{{cite journal | vauthors = Xiang R, Yu Z, Wang Y, Wang L, Huo S, Li Y, Liang R, Hao Q, Ying T, Gao Y, Yu F, Jiang S | display-authors = 6 | title = Recent advances in developing small-molecule inhibitors against SARS-CoV-2 | journal = Acta Pharmaceutica Sinica B | date = July 2021 | volume = 12 | issue = 4 | pages = 1591–1623 | pmid = 34249607 | doi = 10.1016/j.apsb.2021.06.016 | pmc = 8260826 }}</ref>
== See also ==
* [[3CLpro-1]]
* [[Ebselen]]
* [[GC376]]
== References ==
{{Reflist}}
[[Category:Antiviral drugs]]
[[Category:1-Naphthyl compounds]]
[[Category:Anilines]]
[[Category:Benzamides]]
{{antiinfective-drug-stub}}