View source for JWH-148

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = (4-Methyl-1-naphthalenyl)(2-methyl-1-propyl-1''H''-indol-3-yl)methanone
| image = JWH-148.png
| width = 150
<!--Clinical data-->
| tradename =
| legal_status =
| routes_of_administration =
| legal_US = Schedule I
<!--Pharmacokinetic data-->
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 824955-99-9
| PubChem = 45267819
| ChemSpiderID      = 24627234
<!--Chemical data-->
| C=24 | H=23 | N=1 | O=1
| smiles = CCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)C)C
| StdInChI          = 1S/C24H23NO/c1-4-15-25-17(3)23(21-11-7-8-12-22(21)25)24(26)20-14-13-16(2)18-9-5-6-10-19(18)20/h5-14H,4,15H2,1-3H3
| StdInChIKey       = WRIOMNWYCFMMEY-UHFFFAOYSA-N
}}
'''JWH-148''' is a synthetic cannabimimetic that was discovered by [[John W. Huffman]]. It is the indole 2-methyl analog of [[JWH-120]]. It is a moderately selective ligand for the [[Cannabinoid receptor 2|CB<sub>2</sub>]] receptor, with a binding affinity of ''K''<sub>i</sub> = 14.0 ± 1.0 nM at this subtype, and more than eight times selectivity over the CB<sub>1</sub> subtype.<ref>{{cite journal | vauthors = Huffman JW, Zengin G, Wu MJ, Lu J, Hynd G, Bushell K, Thompson AL, Bushell S, Tartal C, Hurst DP, Reggio PH, Selley DE, Cassidy MP, Wiley JL, Martin BR | display-authors = 6 | title = Structure-activity relationships for 1-alkyl-3-(1-naphthoyl)indoles at the cannabinoid CB(1) and CB(2) receptors: steric and electronic effects of naphthoyl substituents. New highly selective CB(2) receptor agonists | journal = Bioorganic & Medicinal Chemistry | volume = 13 | issue = 1 | pages = 89–112 | date = January 2005 | pmid = 15582455 | doi = 10.1016/j.bmc.2004.09.050 }}</ref>
In the United States, all CB<sub>1</sub> receptor agonists of the 3-(1-naphthoyl)indole class such as JWH-148 are [[Schedule I Controlled Substance]]s.<ref>{{UnitedStatesCode2|21|812|Schedules of controlled substances}}</ref>
== See also ==
* [[JWH-120]]
* [[JWH-122]]
* [[JWH-193]]
* [[JWH-210]]
* [[JWH-398]]
== References ==
{{reflist}}
{{Cannabinoids}}
{{cannabinoid-stub}}
[[Category:JWH cannabinoids]]
[[Category:Naphthoylindoles]]
[[Category:CB1 receptor agonists]]
[[Category:CB2 receptor agonists]]