View source for JWH-161

{{short description|Chemical}}
{{Drugbox
| verifiedrevid = 413559074
| IUPAC_name = (4aR,13bR)-2,5,5-trimethyl-8-pentyl-3,4,4a,5,8,13b-hexahydroisochromeno[3,4-b]carbazol-13-ol
| image = JWH-161.svg
| width = 240
<!--Clinical data-->
| tradename =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number =
| PubChem = 10431286
| ChemSpiderID      = 8606713
<!--Chemical data-->
| C=27 | H=33 | N=1 | O=2
| smiles            = Oc3c5c1ccccc1n(c5cc2OC([C@@H]4CC/C(=C\[C@H]4c23)C)(C)C)CCCCC
| StdInChI          = 1S/C27H33NO2/c1-5-6-9-14-28-21-11-8-7-10-18(21)24-22(28)16-23-25(26(24)29)19-15-17(2)12-13-20(19)27(3,4)30-23/h7-8,10-11,15-16,19-20,29H,5-6,9,12-14H2,1-4H3/t19-,20-/m1/s1
| StdInChIKey       = VDJUAFPNHZRTNL-WOJBJXKFSA-N
}}
'''JWH-161''' is a cannabinoid derivative that was designed by Dr [[John W. Huffman]]'s team as a hybrid between the [[dibenzopyran]] "classical" [[cannabinoid]] drugs and the novel [[indole]] derivatives, in an attempt to unravel the differences in their binding modes to the CB<sub>1</sub> receptor. While retaining structural elements from both families, JWH-161 has a [[Cannabinoid receptor type 1|CB<sub>1</sub>]] [[Dissociation constant#Protein-ligand binding|K<sub>i</sub>]] of 19.0nM, although it was found to be slightly weaker than [[tetrahydrocannabinol|THC]] in animal tests.<ref name="pmid15974991">{{cite journal |vauthors=Huffman JW, Padgett LW |title=Recent developments in the medicinal chemistry of cannabimimetic indoles, pyrroles and indenes |journal=Current Medicinal Chemistry |volume=12 |issue=12 |pages=1395–411 |year=2005 |pmid=15974991 |doi= 10.2174/0929867054020864}}</ref>
==References==
<references/>
{{Cannabinoids}}
[[Category:Carbazoles]]
[[Category:Benzochromenes]]
[[Category:JWH cannabinoids]]
[[Category:Phenol ethers]]
[[Category:Heterocyclic compounds with 5 rings]]
[[Category:Nitrogen heterocycles]]
[[Category:Oxygen heterocycles]]
{{cannabinoid-stub}}