View source for Kaempferol 3-O-rutinoside

{{DISPLAYTITLE:Kaempferol 3-''O''-rutinoside}}
{{chembox
| Name = Kaempferol 3-''O''-rutinoside
| Verifiedfields =
| verifiedrevid =
| ImageFile = Kaempferol 3-O-rutinoside.svg
| ImageSize = 200px
| IUPACName = 7-[(2''S'',3''R'',4''S'',5''S'',6''R'')-4,5-Dihydroxy-6-(hydroxymethyl)-3-[(2''S'',3''R'',4''R'',5''R'',6''S'')-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
| OtherNames = Kaempferol 3-''O''-[[rutinoside]]<br>Kaempferol 3-''O''-rhamnosyl-glucoside<br>Nicotiflorin<br>Kaempferol-3-''O''-β-<small>D</small>-glucopyranoside-7-''O''-α-<small>L</small>-rhamnopyranoside<br>Kaempferol 7-neohesperidoside
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 31921-42-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4056D20K3H
| CASNo1 = 31921-42-3
| ChEBI = 69657
| KEGG = C21833
| EINECS = 241-377-3
| CASNo2 = 17650-84-9
| PubChem1 = 5318767
| PubChem2 = 5483905
| ChemSpiderID = 4477257
| SMILES = C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4oc3c5ccc(cc5)O)O)O)O)O)O)O)O)O
| InChI = 1/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1
| InChIKey = RTATXGUCZHCSNG-QHWHWDPRBU
| StdInChI = 1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1
|  StdInChIKey = RTATXGUCZHCSNG-QHWHWDPRSA-N
}}
|Section2={{Chembox Properties
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>15</sub>
| MolarMass = 594.52 g/mol
| Appearance =
| Density = 1.762 g/mL
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
'''Kaempferol-3-''O''-rutinoside''' is a bitter-tasting flavonol [[glycoside]]. It can be isolated from the rhizomes of the fern ''[[Selliguea feei]]''.<ref>{{Cite journal | doi = 10.1016/S0031-9422(00)97105-X | title = Flavonoids and a proanthocyanidin from rhizomes of Selliguea feei | journal = Phytochemistry | volume = 36 | issue = 2 | pages = 513–518 | year = 1994 | last1 = Baek | first1 = Nam-In | last2 = Kennelly | first2 = Edward J. | last3 = Kardono | first3 = Leonardus B.S. | last4 = Tsauri | first4 = Soefjan | last5 = Padmawinata | first5 = Kosasih | last6 = Doel Soejarto | first6 = D. | last7 = Douglas Kinghorn | first7 = A. }} {{INIST|3300075}}</ref>
== References ==
{{Reflist}}
== External links ==
* [http://www.phenol-explorer.eu/compounds/320 Kaempferol-3-O-rutinoside at www.phenol-explorer.eu]
{{flavonol}}
[[Category:Flavonol rutinosides]]
[[Category:Bitter compounds]]
{{aromatic-stub}}