View source for NJK14047

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{drugbox
| drug_name = NJK14047
| image     = NJK14047_structure.png
| legal_UK =
| legal_DE =
| C = 27 | H = 27 | N = 1 | O = 5
| IUPAC_name = N-cyclopropyl-3-[4-[4-(2,3-dihydroxypropoxy)benzoyl]phenyl]-4-methylbenzamide
| CAS_number        = 1800576-41-3
| CAS_supplemental  =
| ChemSpiderID      = 71060140
| PubChem           = 135395450
| UNII              =
| ChEMBL            =
| DrugBank =
| smiles            = CC1=C(C=C(C=C1)C(=O)NC2CC2)C3=CC=C(C=C3)C(=O)C4=CC=C(C=C4)OCC(CO)O
| StdInChI          = 1S/C27H27NO5/c1-17-2-3-21(27(32)28-22-10-11-22)14-25(17)18-4-6-19(7-5-18)26(31)20-8-12-24(13-9-20)33-16-23(30)15-29/h2-9,12-14,22-23,29-30H,10-11,15-16H2,1H3,(H,28,32)
| StdInChIKey       = ZQIUCYZGBDPMLG-UHFFFAOYSA-N
}}
'''NJK14047''' is a drug which acts as a selective inhibitor of the enzyme [[p38 mitogen-activated protein kinase]] (p38 MAPK). It has [[antiviral]] and [[antiinflammatory]] effects and was originally developed as a potential treatment for inflammatory lung conditions such as [[influenza]]. Subsequent research has also shown promise for various other conditions in which inflammation plays a role, including [[Alzheimer's disease]], [[asthma]], [[arthritis]] and [[psoriasis]].<ref>{{cite journal | vauthors = Choi MS, Heo J, Yi CM, Ban J, Lee NJ, Lee NR, Kim SW, Kim NJ, Inn KS | title = A novel p38 mitogen activated protein kinase (MAPK) specific inhibitor suppresses respiratory syncytial virus and influenza A virus replication by inhibiting virus-induced p38 MAPK activation | journal = Biochemical and Biophysical Research Communications | volume = 477 | issue = 3 | pages = 311–316 | date = August 2016 | doi = 10.1016/j.bbrc.2016.06.111 | pmid = 27346133 }}</ref><ref>{{cite journal | vauthors = Gee MS, Son SH, Jeon SH, Do J, Kim N, Ju YJ, Lee SJ, Chung EK, Inn KS, Kim NJ, Lee JK | title = A selective p38α/β MAPK inhibitor alleviates neuropathology and cognitive impairment, and modulates microglia function in 5XFAD mouse | journal = Alzheimer's Research & Therapy | volume = 12 | issue = 1 | pages = 45 | date = April 2020 | doi = 10.1186/s13195-020-00617-2 | doi-access = free | pmid = 32317025 | pmc = 7175487 }}</ref><ref>{{cite journal | vauthors = Lee JH, Son SH, Kim NJ, Im DS | title = NJK14047 Suppression of the p38 MAPK Ameliorates OVA-Induced Allergic Asthma during Sensitization and Challenge Periods | journal = Biomolecules & Therapeutics | volume = 31 | issue = 2 | pages = 183–192 | date = March 2023 | doi = 10.4062/biomolther.2022.078 | pmid = 36171179 | pmc = 9970832 }}</ref><ref>{{cite journal | vauthors = Lee JH, Lee JE, Son SE, Son SH, Kim NJ, Im DS | title = NJK14047 inhibition of p38 MAPK ameliorates inflammatory immune diseases by suppressing T cell differentiation | journal = International Immunopharmacology | volume = 130 | pages = 111800 | date = March 2024 | doi = 10.1016/j.intimp.2024.111800 | pmid = 38447416 }}</ref>
== See also ==
* [[Pamapimod]]
* [[PH-797804]]
== References ==
{{reflist}}
{{pharm-stub}}
[[Category:Benzamides]]
[[Category:Benzophenones]]
[[Category:Glycerols]]
[[Category:Cyclopropyl compounds]]