View source for Phorbol 12,13-dibutyrate

{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 400761335
| ImageFile = Phorbol 12,13-dibutyrate.png
| ImageSize = 200px
| PIN = (1a''R'',1b''S'',4a''R'',7a''S'',7b''S'',8''R'',9''R'',9a''S'')-4a,7b-Dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1,1a,1b,4,4a,5,7a,7b,8,9-decahydro-9a''H''-cyclopropa[3,4]benzo[1,2-''e'']azulene-9,9a-diyl dibutanoate
| OtherNames = Phorbol dibutyrate; Phorbol 12,13-dibutanoate
|Section1={{Chembox Identifiers
| Abbreviations = PDBu
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 37558-16-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 67MX82CL58
| PubChem = 37783
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 34645
|  InChI = 1/C28H40O8/c1-7-9-20(30)35-24-16(4)27(34)18(22-25(5,6)28(22,24)36-21(31)10-8-2)12-17(14-29)13-26(33)19(27)11-15(3)23(26)32/h11-12,16,18-19,22,24,29,33-34H,7-10,13-14H2,1-6H3/t16-,18+,19-,22-,24-,26-,27-,28-/m1/s1
|  InChIKey = BQJRUJTZSGYBEZ-YVQNUNKEBT
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C28H40O8/c1-7-9-20(30)35-24-16(4)27(34)18(22-25(5,6)28(22,24)36-21(31)10-8-2)12-17(14-29)13-26(33)19(27)11-15(3)23(26)32/h11-12,16,18-19,22,24,29,33-34H,7-10,13-14H2,1-6H3/t16-,18+,19-,22-,24-,26-,27-,28-/m1/s1
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = BQJRUJTZSGYBEZ-YVQNUNKESA-N
| SMILES = CCCC(=O)O[C@@H]1[C@H]([C@]2([C@@H](C=C(C[C@]3([C@H]2C=C(C3=O)C)O)CO)[C@H]4[C@@]1(C4(C)C)OC(=O)CCC)O)C
|  ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 17598
|  KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C03634}}
|Section2={{Chembox Properties
| C=28 | H=40 | O=8
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
'''Phorbol 12,13-dibutyrate''' ('''PDBu''') is a [[phorbol ester]] which is one of the constituents of [[croton oil]].  As an activator of [[protein kinase C]], it is a weak tumor promoter compared to [[12-O-Tetradecanoylphorbol-13-acetate|12-''O''-tetradecanoylphorbol-13-acetate]].<ref>{{cite journal|doi=10.1111/j.1749-6632.1983.tb47836.x|vauthors=Blumberg PM, Delclos KB, Dunn JA, Jaken S, Leach KL, Yeh E | year=1983 | title=Phorbol ester receptors and the in vitro effects of tumor promoters | journal=Annals of the New York Academy of Sciences | volume=407  |issue=1 | pages=303–315|pmid=6309054|bibcode=1983NYASA.407..303B |s2cid=20089027 }}</ref>
PDBu is widely used as a chemical reagent because of its [[solubility]] in water and other organic solvents.
==References==
{{reflist}}
[[Category:Butyrate esters]]
[[Category:Diterpenes]]
[[Category:Alcohols]]
[[Category:Ketones]]
[[Category:Carcinogens]]
[[Category:Cyclopentenes]]
[[Category:Phorbol esters]]