View source for Selinene

{{Chembox
| Name = Selinenes
| ImageFileL1 = Alpha-selinene.svg
| ImageCaptionL1 = α-Selinene
| ImageFileR1 = beta-selinene.svg
| ImageCaptionR1 = β-Selinene
| ImageFileL2 = gamma-selinene.svg
| ImageCaptionL2 = γ-Selinene
| ImageFileR2 = (+)-Delta-selinene.svg
| ImageCaptionR2 = δ-Selinene
| IUPACName = α: Eudesma-3,11-diene<br> β: Eudesma-4(14),11-diene<br> γ: Eudesma-4(14),7(11)-diene<br> δ: Eudesma-4,6-diene
| SystematicName = α: (2''R'',4a''R'',8a''R'')-2-Isopropenyl-4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene <br>β: (4a''R'',7''R'',8a''S'')-7-Isopropenyl-4a-methyl-1-methylenedecahydronaphthalene <br>γ: (4a''R'',8a''S'')-7-Isopropylidene-4a-methyl-1-methylenedecahydronaphthalene <br>δ: (3''R'',4a''S'',5''R'',8a''S'')-3-Isopropyl-5,8a-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene
| OtherNames = Selina-3,11-diene (α); beta-Eudesmene (β)
|Section1={{Chembox Identifiers
| CASNo = 473-13-2
| CASNo_Comment = (α)
| CASNo_Ref = {{cascite|correct|}}
| CASNo1 = 17066-67-0
| CASNo1_Comment = (β)
| CASNo1_Ref = {{cascite|correct|}}
| CASNo2 = 515-17-3
| CASNo2_Comment = (γ)
| CASNo2_Ref = {{cascite|correct|}}
| CASNo3 = 473-14-3
| CASNo3_Comment = (δ)
| CASNo3_Ref = {{cascite|correct|}}
| UNII = 99ZHA8F274
| UNII_Comment = (α)
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 10856614
| PubChem_Comment = (α)
| PubChem1 = 442393
| PubChem1_Comment = (β)
| PubChem2 = 10655819
| PubChem2_Comment = (γ)
| ChemSpiderID = 9031905
| ChemSpiderID_Comment = (α)
| ChemSpiderID1 = 390838
| ChemSpiderID1_Comment = (β)
| ChemSpiderID2 = 8831174
| ChemSpiderID2_Comment = (γ)
| ChemSpiderID3 = 23254820
| ChemSpiderID3_Comment = (δ)
| SMILES = C\1(=C\CC[C@]2([C@H]/1C[C@H](\C(=C)C)CC2)C)C
| SMILES_Comment = (α)
| InChI = 1/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1
| InChI_Comment = (α)
| InChIKey = OZQAPQSEYFAMCY-QLFBSQMIBC
| SMILES1 = C1(=C)\CCC[C@]2([C@H]1C[C@H](\C(=C)C)CC2)C
| SMILES1_Comment = (β)
| InChI1 = 1/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1
| InChI1_Comment = (β)
| InChIKey1 = YOVSPTNQHMDJAG-QLFBSQMIBC
| SMILES2 = C2(=C(/C)C)\CC[C@@]1([C@H](/C(=C)CCC1)C2)C
| SMILES2_Comment = (γ)
| InChI2 = 1/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h14H,3,5-10H2,1-2,4H3/t14-,15+/m0/s1
| InChI2_Comment = (γ)
| InChIKey2 = RMZHSBMIZBMVMN-LSDHHAIUBU
| SMILES3 = C[C@@H]1CC=C[C@]2([C@H]1C[C@@H](CC2)C(C)C)C
| SMILES3_Comment = (δ)
| InChI3 = 1/C15H26/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h5,8,11-14H,6-7,9-10H2,1-4H3/t12-,13-,14+,15-/m1/s1
| InChI3_Comment = (δ)
| InChIKey3 = LISVWFDKWZILCJ-APIJFGDWBH
}}
|Section2={{Chembox Properties
| C=15 | H=24
| Appearance =
| Density = α: 0.914 g/cm<sup>3</sup> (20 °C)<ref>{{Cite journal | author1 = Ruzicka, L. | authorlink1 = Leopold Ružička | journal = Helvetica Chimica Acta | year = 1923 | volume = 6 | pages = 846–855 | doi = 10.1002/hlca.19230060192 | title = Höhere Terpenverbindungen XIV. Zur Kenntnis des Selinens und der Sesquiterpenalkohole des Selleriesamenöls | last2 = Stoll | first2 = M. }}</ref> <br>β: 0.915 g/cm<sup>3</sup> (20 °C)<ref>{{Cite journal | author = Tyagi, B. S. | journal = Tetrahedron | year = 1963 | volume = 19 | issue = 7 | pages = 1189–1193 | doi = 10.1016/S0040-4020(01)98579-5 | title = Terpenoids—XLIII | last2 = Ghatge | first2 = B.B. | last3 = Bhattacharyya | first3 = S.C.}}</ref>
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
'''Selinenes''' are a group of closely related [[isomer]]ic [[chemical compound]]s which are classified as [[sesquiterpenes]].  The selinenes all have the molecular formula C<sub>15</sub>H<sub>24</sub> and they have been isolated from a variety of plant sources.  α-Selinene and β-selinene are the most common and are two of the principal components of the oil from [[celery seed]]s.<ref>{{cite book | title = Natural Food Flavors and Colorants | author = Mathew Attokaran | url = https://books.google.com/books?id=9qcvAoMPYW4C&q=selinene+%22celery+seed+oil%22&pg=PT183 | publisher = John Wiley & Sons | date = Jan 13, 2011 | isbn = 9780470959114}}</ref>  γ-Selinene and δ-selinene are less common.
==References==
{{reflist}}
[[Category:Sesquiterpenes]]
[[Category:Hydrocarbons]]