View source for WAY-208466

{{Short description|Chemical compound}}
{{Drugbox
| image = WAY208466.png
| alt = Skeletal formula of WAY-208,466
| width = 200
| IUPAC_name = 2-{3-[(3-Fluorophenyl)sulfonyl]-1''H''-pyrrolo[2,3-''b'']pyridin-1-yl}-''N'',''N''-dimethylethanamine
<!--Clinical data-->
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number = 633304-27-5
| CAS_supplemental = <br />1207064-61-6 (2 [[hydrochloride|HCl]])
| ATC_prefix = none
| ATC_suffix =
| PubChem = 10337743
| ChEMBL = 571858
| UNII = 0AXW9ALG9W
| ChemSpiderID = 8513202
<!--Chemical data-->
| C=17 | H=18 | F=1 | N=3 | O=2 | S=1
| smiles = CN(C)CCN1C=C(C2=C1N=CC=C2)S(=O)(=O)C3=CC=CC(=C3)F
}}
'''WAY-208466''' is a [[potency (pharmacology)|potent]] and highly [[binding selectivity|selective]] [[full agonist]] of the [[5-HT6 receptor|5-HT<sub>6</sub> receptor]].<ref name="pmid17625499">{{cite journal  |vauthors=Schechter LE, Lin Q, Smith DL, etal | title = Neuropharmacological profile of novel and selective 5-HT6 receptor agonists: WAY-181187 and WAY-208466 | journal = Neuropsychopharmacology | volume = 33 | issue = 6 | pages = 1323–35 |date=May 2008 | pmid = 17625499 | doi = 10.1038/sj.npp.1301503 | doi-access = free }}</ref> It increases [[GABA]] levels in the [[cerebral cortex]] and [[drug tolerance|tolerance]] does not appear to occur to this action upon chronic administration.<ref name="pmid17625499"/> Animal studies have shown that WAY-208466 produces [[antidepressant]] and [[anxiolytic]] effects in rodents and it may also be useful in the treatment of [[obsessive-compulsive disorder]].<ref name="pmid17625499"/><ref name="pmid20217056">{{cite journal |vauthors=Carr GV, Schechter LE, Lucki I | title = Antidepressant and anxiolytic effects of selective 5-HT(6) receptor agonists in rats | journal = Psychopharmacology | volume = 213| issue = 2–3| pages = 499–507|date=March 2010 | pmid = 20217056 | doi = 10.1007/s00213-010-1798-7 | pmc=2910165}}</ref>
== See also ==
* [[WAY-181187]]
== References ==
{{Reflist}}
{{Serotonin receptor modulators}}
[[Category:5-HT6 agonists]]
[[Category:Experimental antidepressants]]
[[Category:3-Fluorophenyl compounds]]
[[Category:Tertiary amines]]
[[Category:Sulfuryl compounds]]
[[Category:Pyrrolopyridines]]